C25H26N4O5S — CID 18989285
3-(4-carbamimidoylphenyl)-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxopiperidin-1-yl]propanoic acid (PubChem CID 18989285) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 3-(4-carbamimidoylphenyl)-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxopiperidin-1-yl]propanoic acid.
| Compound Name | 3-(4-carbamimidoylphenyl)-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxopiperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 18989285 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-(4-carbamimidoylphenyl)-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxopiperidin-1-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)O)N2CCCC(NS(=O)(=O)c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C25H26N4O5S/c26-23(27)18-9-7-16(8-10-18)14-22(25(31)32)29-13-3-6-21(24(29)30)28-35(33,34)20-12-11-17-4-1-2-5-19(17)15-20/h1-2,4-5,7-12,15,21-22,28H,3,6,13-14H2,(H3,26,27)(H,31,32) |
| InChIKey | LYJVBJFSYBQBAY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|