C21H31N5O5S — CID 54386503
N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide (PubChem CID 54386503) has the molecular formula C21H31N5O5S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide.
| Compound Name | N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 54386503 |
| Molecular Formula | C21H31N5O5S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide |
| SMILES | C=C(N)NCCCC(C=O)NC(=O)CN1CCCC(NS(=O)(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H31N5O5S/c1-16(22)23-11-5-9-18(14-27)24-20(28)13-26-12-6-10-19(21(26)29)25-32(30,31)15-17-7-3-2-4-8-17/h2-4,7-8,14,18-19,23,25H,1,5-6,9-13,15,22H2,(H,24,28) |
| InChIKey | VDPLZOFTJUPGQU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|