C19H29N7O7S — CID 135528135
2-[(3S)-3-(benzylsulfonylamino)-2-oxopyrrolidin-1-yl]-N-[(2S)-1-hydroxy-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentan-2-yl]acetamide (PubChem CID 135528135) has the molecular formula C19H29N7O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is 2-[(3S)-3-(benzylsulfonylamino)-2-oxopyrrolidin-1-yl]-N-[(2S)-1-hydroxy-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentan-2-yl]acetamide.
| Compound Name | 2-[(3S)-3-(benzylsulfonylamino)-2-oxopyrrolidin-1-yl]-N-[(2S)-1-hydroxy-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 135528135 |
| Molecular Formula | C19H29N7O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[(3S)-3-(benzylsulfonylamino)-2-oxopyrrolidin-1-yl]-N-[(2S)-1-hydroxy-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentan-2-yl]acetamide |
| SMILES | N/C(=N\[N+](=O)[O-])NCCC[C@@H](CO)NC(=O)CN1CC[C@H](NS(=O)(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H29N7O7S/c20-19(23-26(30)31)21-9-4-7-15(12-27)22-17(28)11-25-10-8-16(18(25)29)24-34(32,33)13-14-5-2-1-3-6-14/h1-3,5-6,15-16,24,27H,4,7-13H2,(H,22,28)(H3,20,21,23)/t15-,16-/m0/s1 |
| InChIKey | AAPFWRBEESIPAD-HOTGVXAUSA-N |
| XLogP | -1.94 |
| TPSA | 209.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|