C28H33N7O6S — CID 139821734
(2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylmethyl)phenyl]methyl]pentanamide (PubChem CID 139821734) has the molecular formula C28H33N7O6S and a molecular weight of 595.68 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylmethyl)phenyl]methyl]pentanamide.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylmethyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 139821734 |
| Molecular Formula | C28H33N7O6S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylmethyl)phenyl]methyl]pentanamide |
| SMILES | NC(=N[N+](=O)[O-])NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C28H33N7O6S/c29-28(34-35(38)39)31-17-7-12-24(26(36)32-18-20-13-15-21(16-14-20)19-42(30,40)41)33-27(37)25(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,24-25H,7,12,17-19H2,(H,32,36)(H,33,37)(H3,29,31,34)(H2,30,40,41)/t24-/m1/s1 |
| InChIKey | FVDRYJIZZYBWMF-XMMPIXPASA-N |
| XLogP | 1.28 |
| TPSA | 211.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|