C29H35N7O4 — CID 67792178
(2S)-5,6-diamino-N-[[4-(dimethylamino)phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]-6-nitroiminohexanamide (PubChem CID 67792178) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is (2S)-5,6-diamino-N-[[4-(dimethylamino)phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]-6-nitroiminohexanamide.
| Compound Name | (2S)-5,6-diamino-N-[[4-(dimethylamino)phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]-6-nitroiminohexanamide |
|---|---|
| PubChem CID | 67792178 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | (2S)-5,6-diamino-N-[[4-(dimethylamino)phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]-6-nitroiminohexanamide |
| SMILES | CN(C)c1ccc(CNC(=O)[C@H](CCC(N)C(N)=N[N+](=O)[O-])NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N7O4/c1-35(2)23-15-13-20(14-16-23)19-32-28(37)25(18-17-24(30)27(31)34-36(39)40)33-29(38)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,24-26H,17-19,30H2,1-2H3,(H2,31,34)(H,32,37)(H,33,38)/t24?,25-/m0/s1 |
| InChIKey | AHLMVLMQVMXUMY-BBMPLOMVSA-N |
| XLogP | 2.34 |
| TPSA | 168.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|