C27H32N8O6S — CID 139693131
(2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylamino)phenyl]methyl]pentanamide (PubChem CID 139693131) has the molecular formula C27H32N8O6S and a molecular weight of 596.67 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylamino)phenyl]methyl]pentanamide.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylamino)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 139693131 |
| Molecular Formula | C27H32N8O6S |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]-N-[[4-(sulfamoylamino)phenyl]methyl]pentanamide |
| SMILES | NC(=N[N+](=O)[O-])NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H32N8O6S/c28-27(33-35(38)39)30-17-7-12-23(25(36)31-18-19-13-15-22(16-14-19)34-42(29,40)41)32-26(37)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24,34H,7,12,17-18H2,(H,31,36)(H,32,37)(H3,28,30,33)(H2,29,40,41)/t23-/m1/s1 |
| InChIKey | RTFZHAILBSTDGG-HSZRJFAPSA-N |
| XLogP | 1.11 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|