C24H29N9O5 — CID 139821742
N-[(2R)-1-[[4-[(carbamoylamino)methyl]phenyl]methylamino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-1H-indole-3-carboxamide (PubChem CID 139821742) has the molecular formula C24H29N9O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is N-[(2R)-1-[[4-[(carbamoylamino)methyl]phenyl]methylamino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-1H-indole-3-carboxamide.
| Compound Name | N-[(2R)-1-[[4-[(carbamoylamino)methyl]phenyl]methylamino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 139821742 |
| Molecular Formula | C24H29N9O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-[(2R)-1-[[4-[(carbamoylamino)methyl]phenyl]methylamino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-1H-indole-3-carboxamide |
| SMILES | NC(=O)NCc1ccc(CNC(=O)[C@@H](CCCNC(N)=N[N+](=O)[O-])NC(=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H29N9O5/c25-23(32-33(37)38)27-11-3-6-20(31-21(34)18-14-28-19-5-2-1-4-17(18)19)22(35)29-12-15-7-9-16(10-8-15)13-30-24(26)36/h1-2,4-5,7-10,14,20,28H,3,6,11-13H2,(H,29,35)(H,31,34)(H3,25,27,32)(H3,26,30,36)/t20-/m1/s1 |
| InChIKey | NHDIIVWSGRTROC-HXUWFJFHSA-N |
| XLogP | 0.63 |
| TPSA | 222.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|