C27H25N3O4 — CID 67946126
5-(benzhydrylamino)-4-(1H-indole-3-carbonylamino)-5-oxopentanoic acid (PubChem CID 67946126) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 5-(benzhydrylamino)-4-(1H-indole-3-carbonylamino)-5-oxopentanoic acid.
| Compound Name | 5-(benzhydrylamino)-4-(1H-indole-3-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67946126 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 5-(benzhydrylamino)-4-(1H-indole-3-carbonylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(NC(=O)c1c[nH]c2ccccc12)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O4/c31-24(32)16-15-23(29-26(33)21-17-28-22-14-8-7-13-20(21)22)27(34)30-25(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,17,23,25,28H,15-16H2,(H,29,33)(H,30,34)(H,31,32) |
| InChIKey | IBTSEEUYBAXPBX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |