ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid

C18H24N2O4 — CID 143041569

IUPACethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid
SMILESCC.CC(=O)C(CCC(=O)O)NC(=O)Cc1c[nH]c2ccccc12
InChIInChI=1S/C16H18N2O4.C2H6/c1-10(19)13(6-7-16(21)22)18-15(20)8-11-9-17-14-5-3-2-4-12(11)14;1-2/h2-5,9,13,17H,6-8H2,1H3,(H,18,20)(H,21,22);1-2H3
InChIKeyIVWQKWDZDAYEMV-UHFFFAOYSA-N
MW332.40 g/mol
LogP2.68
Rot. Bonds7

About ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid

ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid (PubChem CID 143041569) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid.

Molecular Properties

Compound Nameethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid
PubChem CID143041569
Molecular FormulaC18H24N2O4
Molecular Weight332.40 g/mol
Exact Mass332.17
IUPAC Nameethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid
SMILESCC.CC(=O)C(CCC(=O)O)NC(=O)Cc1c[nH]c2ccccc12
InChIInChI=1S/C16H18N2O4.C2H6/c1-10(19)13(6-7-16(21)22)18-15(20)8-11-9-17-14-5-3-2-4-12(11)14;1-2/h2-5,9,13,17H,6-8H2,1H3,(H,18,20)(H,21,22);1-2H3
InChIKeyIVWQKWDZDAYEMV-UHFFFAOYSA-N
XLogP2.68
TPSA99.26 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.40
LogP ≤ 52.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid?
The IUPAC name of ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid (CID 143041569) is ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid.
What is the SMILES notation for ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid?
The canonical SMILES for ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid is CC.CC(=O)C(CCC(=O)O)NC(=O)Cc1c[nH]c2ccccc12.
What is the InChIKey of ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid?
The InChIKey is IVWQKWDZDAYEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4.C2H6/c1-10(19)13(6-7-16(21)22)18-15(20)8-11-9-17-14-5-3-2-4-12(11)14;1-2/h2-5,9,13,17H,6-8H2,1H3,(H,18,20)(H,21,22);1-2H3.
What are the key properties of ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid?
ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid has a molecular weight of 332.40 g/mol, XLogP of 2.68, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid is sourced from PubChem (CID 143041569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).