C18H24N2O4 — CID 143041569
ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid (PubChem CID 143041569) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid.
| Compound Name | ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 143041569 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | ethane;4-[[2-(1H-indol-3-yl)acetyl]amino]-5-oxohexanoic acid |
| SMILES | CC.CC(=O)C(CCC(=O)O)NC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N2O4.C2H6/c1-10(19)13(6-7-16(21)22)18-15(20)8-11-9-17-14-5-3-2-4-12(11)14;1-2/h2-5,9,13,17H,6-8H2,1H3,(H,18,20)(H,21,22);1-2H3 |
| InChIKey | IVWQKWDZDAYEMV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |