C24H29N9O5 — CID 54489958
N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-1H-indole-3-carboxamide (PubChem CID 54489958) has the molecular formula C24H29N9O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-1H-indole-3-carboxamide.
| Compound Name | N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 54489958 |
| Molecular Formula | C24H29N9O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-1H-indole-3-carboxamide |
| SMILES | NC(=O)NCc1ccc(CN(C(=O)c2c[nH]c3ccccc23)[C@H](CCC/N=C(\N)N[N+](=O)[O-])C(N)=O)cc1 |
| InChI | InChI=1S/C24H29N9O5/c25-21(34)20(6-3-11-28-23(26)31-33(37)38)32(14-16-9-7-15(8-10-16)12-30-24(27)36)22(35)18-13-29-19-5-2-1-4-17(18)19/h1-2,4-5,7-10,13,20,29H,3,6,11-12,14H2,(H2,25,34)(H3,26,28,31)(H3,27,30,36)/t20-/m1/s1 |
| InChIKey | XUZXMVGACMVXAQ-HXUWFJFHSA-N |
| XLogP | 0.71 |
| TPSA | 227.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|