C32H47N9O3 — CID 54071957
(2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-[1-[3-(diethylamino)propyl]indol-3-yl]acetyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 54071957) has the molecular formula C32H47N9O3 and a molecular weight of 605.79 g/mol. Its IUPAC name is (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-[1-[3-(diethylamino)propyl]indol-3-yl]acetyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-[1-[3-(diethylamino)propyl]indol-3-yl]acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 54071957 |
| Molecular Formula | C32H47N9O3 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.38 |
| IUPAC Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-[1-[3-(diethylamino)propyl]indol-3-yl]acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CCN(CC)CCCn1cc(CC(=O)N(Cc2ccc(CNC(N)=O)cc2)[C@H](CCCN=C(N)N)C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C32H47N9O3/c1-3-39(4-2)17-8-18-40-22-25(26-9-5-6-10-27(26)40)19-29(42)41(28(30(33)43)11-7-16-37-31(34)35)21-24-14-12-23(13-15-24)20-38-32(36)44/h5-6,9-10,12-15,22,28H,3-4,7-8,11,16-21H2,1-2H3,(H2,33,43)(H4,34,35,37)(H3,36,38,44)/t28-/m1/s1 |
| InChIKey | MHBPYZZCHNFBID-MUUNZHRXSA-N |
| XLogP | 2.02 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|