C26H34N8O3 — CID 54186942
(2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-(1-methylindol-3-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 54186942) has the molecular formula C26H34N8O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-(1-methylindol-3-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-(1-methylindol-3-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 54186942 |
| Molecular Formula | C26H34N8O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-[2-(1-methylindol-3-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | Cn1cc(CC(=O)N(Cc2ccc(CNC(N)=O)cc2)[C@H](CCCN=C(N)N)C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C26H34N8O3/c1-33-16-19(20-5-2-3-6-21(20)33)13-23(35)34(22(24(27)36)7-4-12-31-25(28)29)15-18-10-8-17(9-11-18)14-32-26(30)37/h2-3,5-6,8-11,16,22H,4,7,12-15H2,1H3,(H2,27,36)(H4,28,29,31)(H3,30,32,37)/t22-/m1/s1 |
| InChIKey | PFTFHDVXWUIOSQ-JOCHJYFZSA-N |
| XLogP | 0.83 |
| TPSA | 187.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|