C31H35N5O4 — CID 67015262
N-[(4-acetylphenyl)methyl]-2-[bis(2-phenylacetyl)amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 67015262) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is N-[(4-acetylphenyl)methyl]-2-[bis(2-phenylacetyl)amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | N-[(4-acetylphenyl)methyl]-2-[bis(2-phenylacetyl)amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 67015262 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | N-[(4-acetylphenyl)methyl]-2-[bis(2-phenylacetyl)amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)c1ccc(CNC(=O)C(CCCN=C(N)N)N(C(=O)Cc2ccccc2)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H35N5O4/c1-22(37)26-16-14-25(15-17-26)21-35-30(40)27(13-8-18-34-31(32)33)36(28(38)19-23-9-4-2-5-10-23)29(39)20-24-11-6-3-7-12-24/h2-7,9-12,14-17,27H,8,13,18-21H2,1H3,(H,35,40)(H4,32,33,34) |
| InChIKey | HHNGMPRMXCUCQJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|