C24H28Cl2N6O5 — CID 70189514
(2S)-2-[[3-(3-acetylanilino)-3-oxopropanoyl]-[(3,4-dichlorophenyl)methylamino]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 70189514) has the molecular formula C24H28Cl2N6O5 and a molecular weight of 551.43 g/mol. Its IUPAC name is (2S)-2-[[3-(3-acetylanilino)-3-oxopropanoyl]-[(3,4-dichlorophenyl)methylamino]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-(3-acetylanilino)-3-oxopropanoyl]-[(3,4-dichlorophenyl)methylamino]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 70189514 |
| Molecular Formula | C24H28Cl2N6O5 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | (2S)-2-[[3-(3-acetylanilino)-3-oxopropanoyl]-[(3,4-dichlorophenyl)methylamino]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)c1cccc(NC(=O)CC(=O)N(NCc2ccc(Cl)c(Cl)c2)[C@@H](CCCN=C(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C24H28Cl2N6O5/c1-14(33)16-4-2-5-17(11-16)31-21(34)12-22(35)32(20(23(36)37)6-3-9-29-24(27)28)30-13-15-7-8-18(25)19(26)10-15/h2,4-5,7-8,10-11,20,30H,3,6,9,12-13H2,1H3,(H,31,34)(H,36,37)(H4,27,28,29)/t20-/m0/s1 |
| InChIKey | FOFIZHVBXSDFIA-FQEVSTJZSA-N |
| XLogP | 2.56 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|