methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate

C17H15Cl2NO3 — CID 100595486

IUPACmethyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)CCc2ccc(Cl)c(Cl)c2)c1
InChIInChI=1S/C17H15Cl2NO3/c1-23-17(22)12-3-2-4-13(10-12)20-16(21)8-6-11-5-7-14(18)15(19)9-11/h2-5,7,9-10H,6,8H2,1H3,(H,20,21)
InChIKeyLYYFYQAIQVZRKD-UHFFFAOYSA-N
MW352.22 g/mol
LogP4.35
Rot. Bonds5

About methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate

methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate (PubChem CID 100595486) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate.

Molecular Properties

Compound Namemethyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate
PubChem CID100595486
Molecular FormulaC17H15Cl2NO3
Molecular Weight352.22 g/mol
Exact Mass351.04
IUPAC Namemethyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)CCc2ccc(Cl)c(Cl)c2)c1
InChIInChI=1S/C17H15Cl2NO3/c1-23-17(22)12-3-2-4-13(10-12)20-16(21)8-6-11-5-7-14(18)15(19)9-11/h2-5,7,9-10H,6,8H2,1H3,(H,20,21)
InChIKeyLYYFYQAIQVZRKD-UHFFFAOYSA-N
XLogP4.35
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.22
LogP ≤ 54.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate?
The IUPAC name of methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate (CID 100595486) is methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate.
What is the SMILES notation for methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate?
The canonical SMILES for methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate is COC(=O)c1cccc(NC(=O)CCc2ccc(Cl)c(Cl)c2)c1.
What is the InChIKey of methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate?
The InChIKey is LYYFYQAIQVZRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO3/c1-23-17(22)12-3-2-4-13(10-12)20-16(21)8-6-11-5-7-14(18)15(19)9-11/h2-5,7,9-10H,6,8H2,1H3,(H,20,21).
What are the key properties of methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate?
methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate has a molecular weight of 352.22 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(3,4-dichlorophenyl)propanoylamino]benzoate is sourced from PubChem (CID 100595486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).