C19H17N3O3S — CID 110330071
methyl 3-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)propanoylamino]benzoate (PubChem CID 110330071) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 3-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)propanoylamino]benzoate.
| Compound Name | methyl 3-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 110330071 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | methyl 3-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCc2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C19H17N3O3S/c1-25-19(24)14-3-2-4-15(11-14)21-17(23)6-5-16-12-26-18(22-16)13-7-9-20-10-8-13/h2-4,7-12H,5-6H2,1H3,(H,21,23) |
| InChIKey | DFPYSVOLRUYXQO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |