C28H30Cl2N6O5 — CID 54502148
(2S)-2-[acetyl-[(4-phenoxyphenyl)carbamoyl]amino]-5-(diaminomethylideneamino)-2-[(3,4-dichlorophenyl)methylamino]pentanoic acid (PubChem CID 54502148) has the molecular formula C28H30Cl2N6O5 and a molecular weight of 601.49 g/mol. Its IUPAC name is (2S)-2-[acetyl-[(4-phenoxyphenyl)carbamoyl]amino]-5-(diaminomethylideneamino)-2-[(3,4-dichlorophenyl)methylamino]pentanoic acid.
| Compound Name | (2S)-2-[acetyl-[(4-phenoxyphenyl)carbamoyl]amino]-5-(diaminomethylideneamino)-2-[(3,4-dichlorophenyl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 54502148 |
| Molecular Formula | C28H30Cl2N6O5 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | (2S)-2-[acetyl-[(4-phenoxyphenyl)carbamoyl]amino]-5-(diaminomethylideneamino)-2-[(3,4-dichlorophenyl)methylamino]pentanoic acid |
| SMILES | CC(=O)N(C(=O)Nc1ccc(Oc2ccccc2)cc1)[C@](CCCN=C(N)N)(NCc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C28H30Cl2N6O5/c1-18(37)36(27(40)35-20-9-11-22(12-10-20)41-21-6-3-2-4-7-21)28(25(38)39,14-5-15-33-26(31)32)34-17-19-8-13-23(29)24(30)16-19/h2-4,6-13,16,34H,5,14-15,17H2,1H3,(H,35,40)(H,38,39)(H4,31,32,33)/t28-/m0/s1 |
| InChIKey | YDEHQDFVHXWPEL-NDEPHWFRSA-N |
| XLogP | 4.79 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|