C28H30Cl2N6O5 — CID 70189968
(2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[3-oxo-3-(4-phenoxyanilino)propanoyl]amino]pentanoic acid (PubChem CID 70189968) has the molecular formula C28H30Cl2N6O5 and a molecular weight of 601.49 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[3-oxo-3-(4-phenoxyanilino)propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[3-oxo-3-(4-phenoxyanilino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70189968 |
| Molecular Formula | C28H30Cl2N6O5 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[3-oxo-3-(4-phenoxyanilino)propanoyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N(NCc1ccc(Cl)c(Cl)c1)C(=O)CC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30Cl2N6O5/c29-22-13-8-18(15-23(22)30)17-34-36(24(27(39)40)7-4-14-33-28(31)32)26(38)16-25(37)35-19-9-11-21(12-10-19)41-20-5-2-1-3-6-20/h1-3,5-6,8-13,15,24,34H,4,7,14,16-17H2,(H,35,37)(H,39,40)(H4,31,32,33)/t24-/m0/s1 |
| InChIKey | INAXRMUNZHMEMH-DEOSSOPVSA-N |
| XLogP | 4.15 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|