C29H33N5O5 — CID 54211311
2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-[2-(4-phenylphenyl)acetyl]amino]pentanoyl]amino]acetic acid (PubChem CID 54211311) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-[2-(4-phenylphenyl)acetyl]amino]pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-[2-(4-phenylphenyl)acetyl]amino]pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54211311 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-[2-(4-phenylphenyl)acetyl]amino]pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](C(=O)NCC(=O)O)N(Cc1ccc(O)cc1)C(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N5O5/c30-29(31)32-16-4-7-25(28(39)33-18-27(37)38)34(19-21-10-14-24(35)15-11-21)26(36)17-20-8-12-23(13-9-20)22-5-2-1-3-6-22/h1-3,5-6,8-15,25,35H,4,7,16-19H2,(H,33,39)(H,37,38)(H4,30,31,32)/t25-/m1/s1 |
| InChIKey | PWDKMDGPSBLJEM-RUZDIDTESA-N |
| XLogP | 2.25 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|