C26H29N5O5 — CID 54131793
2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-(naphthalene-2-carbonyl)amino]pentanoyl]amino]acetic acid (PubChem CID 54131793) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-(naphthalene-2-carbonyl)amino]pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-(naphthalene-2-carbonyl)amino]pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54131793 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl-(naphthalene-2-carbonyl)amino]pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](C(=O)NCC(=O)O)N(Cc1ccc(O)cc1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H29N5O5/c27-26(28)29-13-3-6-22(24(35)30-15-23(33)34)31(16-17-7-11-21(32)12-8-17)25(36)20-10-9-18-4-1-2-5-19(18)14-20/h1-2,4-5,7-12,14,22,32H,3,6,13,15-16H2,(H,30,35)(H,33,34)(H4,27,28,29)/t22-/m1/s1 |
| InChIKey | NUWOLQDMOORYLQ-JOCHJYFZSA-N |
| XLogP | 1.81 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|