C20H31N7O6 — CID 22651292
2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetic acid (PubChem CID 22651292) has the molecular formula C20H31N7O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetic acid.
| Compound Name | 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 22651292 |
| Molecular Formula | C20H31N7O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetic acid |
| SMILES | CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H31N7O6/c1-11(17(31)25-10-16(29)30)26-19(33)15(9-12-4-6-13(28)7-5-12)27-18(32)14(21)3-2-8-24-20(22)23/h4-7,11,14-15,28H,2-3,8-10,21H2,1H3,(H,25,31)(H,26,33)(H,27,32)(H,29,30)(H4,22,23,24) |
| InChIKey | AFDAJWBMRCXDKG-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|