C23H36N8O8 — CID 25156231
(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 25156231) has the molecular formula C23H36N8O8 and a molecular weight of 552.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 25156231 |
| Molecular Formula | C23H36N8O8 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C23H36N8O8/c1-12(19(35)31-17(11-32)22(38)39)29-18(34)10-28-21(37)16(9-13-4-6-14(33)7-5-13)30-20(36)15(24)3-2-8-27-23(25)26/h4-7,12,15-17,32-33H,2-3,8-11,24H2,1H3,(H,28,37)(H,29,34)(H,30,36)(H,31,35)(H,38,39)(H4,25,26,27)/t12-,15-,16-,17-/m0/s1 |
| InChIKey | YFOLQELKNMNSNU-STECZYCISA-N |
| XLogP | -4.02 |
| TPSA | 284.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|