C35H37N5O4 — CID 54572534
2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-phenylphenyl)methyl]amino]pentanoyl]amino]acetic acid (PubChem CID 54572534) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is 2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-phenylphenyl)methyl]amino]pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-phenylphenyl)methyl]amino]pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54572534 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | 2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-phenylphenyl)methyl]amino]pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](C(=O)NCC(=O)O)N(Cc1ccc(-c2ccccc2)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H37N5O4/c36-35(37)38-22-10-17-30(33(43)39-23-31(41)42)40(24-25-18-20-27(21-19-25)26-11-4-1-5-12-26)34(44)32(28-13-6-2-7-14-28)29-15-8-3-9-16-29/h1-9,11-16,18-21,30,32H,10,17,22-24H2,(H,39,43)(H,41,42)(H4,36,37,38)/t30-/m1/s1 |
| InChIKey | ZYIINFCWRODKDM-SSEXGKCCSA-N |
| XLogP | 4.14 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|