C27H31N5O3 — CID 57156147
(2R)-4-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]butanamide (PubChem CID 57156147) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is (2R)-4-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | (2R)-4-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 57156147 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (2R)-4-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]butanamide |
| SMILES | COc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C27H31N5O3/c1-35-22-14-12-19(13-15-22)18-32(23(25(28)33)16-17-31-27(29)30)26(34)24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,23-24H,16-18H2,1H3,(H2,28,33)(H4,29,30,31)/t23-/m1/s1 |
| InChIKey | ZSMHWRRPDREGTC-HSZRJFAPSA-N |
| XLogP | 2.37 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|