C29H34N6O5 — CID 57322976
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-methoxyphenyl)ethyl]amino]pentanamide (PubChem CID 57322976) has the molecular formula C29H34N6O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-methoxyphenyl)ethyl]amino]pentanamide.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-methoxyphenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 57322976 |
| Molecular Formula | C29H34N6O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-methoxyphenyl)ethyl]amino]pentanamide |
| SMILES | COc1ccc(CCN(C(=O)C(c2ccccc2)c2ccccc2)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(N)=O)cc1 |
| InChI | InChI=1S/C29H34N6O5/c1-40-24-16-14-21(15-17-24)18-20-34(25(27(30)36)13-8-19-32-29(31)33-35(38)39)28(37)26(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-7,9-12,14-17,25-26H,8,13,18-20H2,1H3,(H2,30,36)(H3,31,32,33)/t25-/m0/s1 |
| InChIKey | IHRGCOZLGOCGFQ-VWLOTQADSA-N |
| XLogP | 2.63 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|