C31H35N7O6 — CID 54565051
N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide (PubChem CID 54565051) has the molecular formula C31H35N7O6 and a molecular weight of 601.66 g/mol. Its IUPAC name is N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 54565051 |
| Molecular Formula | C31H35N7O6 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | N-[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide |
| SMILES | NC(=O)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])N(CCc1ccc(O)cc1)C(=O)c1cc2cc(OCCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C31H35N7O6/c32-29(40)28(7-4-16-34-31(33)36-38(42)43)37(17-14-22-8-10-24(39)11-9-22)30(41)27-20-23-19-25(12-13-26(23)35-27)44-18-15-21-5-2-1-3-6-21/h1-3,5-6,8-13,19-20,28,35,39H,4,7,14-18H2,(H2,32,40)(H3,33,34,36)/t28-/m1/s1 |
| InChIKey | ZTFNQETUEJTJFM-MUUNZHRXSA-N |
| XLogP | 2.91 |
| TPSA | 202.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|