C28H32N6O5 — CID 57124452
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-hydroxyphenyl)ethyl]amino]pentanamide (PubChem CID 57124452) has the molecular formula C28H32N6O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-hydroxyphenyl)ethyl]amino]pentanamide.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-hydroxyphenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 57124452 |
| Molecular Formula | C28H32N6O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-[2-(4-hydroxyphenyl)ethyl]amino]pentanamide |
| SMILES | NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])N(CCc1ccc(O)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N6O5/c29-26(36)24(12-7-18-31-28(30)32-34(38)39)33(19-17-20-13-15-23(35)16-14-20)27(37)25(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-6,8-11,13-16,24-25,35H,7,12,17-19H2,(H2,29,36)(H3,30,31,32)/t24-/m0/s1 |
| InChIKey | MAHTVPUEYLVKGK-DEOSSOPVSA-N |
| XLogP | 2.33 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|