C36H37N9O6 — CID 57065300
(2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)ethyl-(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 57065300) has the molecular formula C36H37N9O6 and a molecular weight of 691.75 g/mol. Its IUPAC name is (2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)ethyl-(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)ethyl-(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 57065300 |
| Molecular Formula | C36H37N9O6 |
| Molecular Weight | 691.75 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)ethyl-(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | NC(=O)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])N(CCn1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37N9O6/c37-32(46)30(22-13-23-39-34(38)40-45(50)51)41(33(47)31(26-14-5-1-6-15-26)27-16-7-2-8-17-27)24-25-42-35(48)43(28-18-9-3-10-19-28)44(36(42)49)29-20-11-4-12-21-29/h1-12,14-21,30-31H,13,22-25H2,(H2,37,46)(H3,38,39,40)/t30-/m1/s1 |
| InChIKey | RCYGFEZABPSOHQ-SSEXGKCCSA-N |
| XLogP | 2.18 |
| TPSA | 205.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|