C28H35N7O4S — CID 67614949
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[2-[(sulfamoylamino)methyl]phenyl]methyl]amino]pentanamide (PubChem CID 67614949) has the molecular formula C28H35N7O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[2-[(sulfamoylamino)methyl]phenyl]methyl]amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[2-[(sulfamoylamino)methyl]phenyl]methyl]amino]pentanamide |
|---|---|
| PubChem CID | 67614949 |
| Molecular Formula | C28H35N7O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[2-[(sulfamoylamino)methyl]phenyl]methyl]amino]pentanamide |
| SMILES | NC(=O)[C@@H](CCCN=C(N)N)N(Cc1ccccc1CNS(N)(=O)=O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35N7O4S/c29-26(36)24(16-9-17-33-28(30)31)35(19-23-15-8-7-14-22(23)18-34-40(32,38)39)27(37)25(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-8,10-15,24-25,34H,9,16-19H2,(H2,29,36)(H4,30,31,33)(H2,32,38,39)/t24-/m1/s1 |
| InChIKey | DOSJGSMJOHWCGP-XMMPIXPASA-N |
| XLogP | 1.05 |
| TPSA | 199.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|