C33H34N4O3 — CID 67810467
5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(2-phenylphenyl)methyl]amino]pentanoic acid (PubChem CID 67810467) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(2-phenylphenyl)methyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(2-phenylphenyl)methyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 67810467 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(2-phenylphenyl)methyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(C(=O)O)N(Cc1ccccc1-c1ccccc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34N4O3/c34-33(35)36-22-12-21-29(32(39)40)37(23-27-19-10-11-20-28(27)24-13-4-1-5-14-24)31(38)30(25-15-6-2-7-16-25)26-17-8-3-9-18-26/h1-11,13-20,29-30H,12,21-23H2,(H,39,40)(H4,34,35,36) |
| InChIKey | VRVCEOYHSLKQGQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|