C33H38N8O3 — CID 54191470
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[4-[[(5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methyl]phenyl]methyl]amino]pentanamide (PubChem CID 54191470) has the molecular formula C33H38N8O3 and a molecular weight of 594.72 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[4-[[(5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methyl]phenyl]methyl]amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[4-[[(5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methyl]phenyl]methyl]amino]pentanamide |
|---|---|
| PubChem CID | 54191470 |
| Molecular Formula | C33H38N8O3 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[[4-[[(5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methyl]phenyl]methyl]amino]pentanamide |
| SMILES | Cc1cnc(NCc2ccc(CN(C(=O)C(c3ccccc3)c3ccccc3)[C@H](CCCN=C(N)N)C(N)=O)cc2)[nH]c1=O |
| InChI | InChI=1S/C33H38N8O3/c1-22-19-38-33(40-30(22)43)39-20-23-14-16-24(17-15-23)21-41(27(29(34)42)13-8-18-37-32(35)36)31(44)28(25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-7,9-12,14-17,19,27-28H,8,13,18,20-21H2,1H3,(H2,34,42)(H4,35,36,37)(H2,38,39,40,43)/t27-/m1/s1 |
| InChIKey | PIUYFMHQOGJDBF-HHHXNRCGSA-N |
| XLogP | 2.76 |
| TPSA | 185.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|