C28H33ClN4O3 — CID 70280051
(2R)-5-(aminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]pentanamide;hydrochloride (PubChem CID 70280051) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is (2R)-5-(aminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]pentanamide;hydrochloride.
| Compound Name | (2R)-5-(aminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 70280051 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | (2R)-5-(aminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]pentanamide;hydrochloride |
| SMILES | COc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCC/N=C/N)C(N)=O)cc1.Cl |
| InChI | InChI=1S/C28H32N4O3.ClH/c1-35-24-16-14-21(15-17-24)19-32(25(27(30)33)13-8-18-31-20-29)28(34)26(22-9-4-2-5-10-22)23-11-6-3-7-12-23;/h2-7,9-12,14-17,20,25-26H,8,13,18-19H2,1H3,(H2,29,31)(H2,30,33);1H/t25-;/m1./s1 |
| InChIKey | YUJRJVNWOFNUNB-VQIWEWKSSA-N |
| XLogP | 3.90 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|