C31H31N3O3 — CID 57038664
(2R)-3-(4-aminophenyl)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 57038664) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2R)-3-(4-aminophenyl)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-3-(4-aminophenyl)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 57038664 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (2R)-3-(4-aminophenyl)-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](Cc2ccc(N)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C31H31N3O3/c1-37-27-18-14-23(15-19-27)21-34(28(30(33)35)20-22-12-16-26(32)17-13-22)31(36)29(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-19,28-29H,20-21,32H2,1H3,(H2,33,35)/t28-/m1/s1 |
| InChIKey | IRVBHPXSBMMBDD-MUUNZHRXSA-N |
| XLogP | 4.53 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|