C33H31N5O3 — CID 57076474
(2R)-3-[4-[(cyanoamino)methylideneamino]phenyl]-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 57076474) has the molecular formula C33H31N5O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is (2R)-3-[4-[(cyanoamino)methylideneamino]phenyl]-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-3-[4-[(cyanoamino)methylideneamino]phenyl]-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 57076474 |
| Molecular Formula | C33H31N5O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2R)-3-[4-[(cyanoamino)methylideneamino]phenyl]-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](Cc2ccc(/N=C/NC#N)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C33H31N5O3/c1-41-29-18-14-25(15-19-29)21-38(30(32(35)39)20-24-12-16-28(17-13-24)37-23-36-22-34)33(40)31(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-19,23,30-31H,20-21H2,1H3,(H2,35,39)(H,36,37)/t30-/m1/s1 |
| InChIKey | UZJLAJJCLGGQLR-SSEXGKCCSA-N |
| XLogP | 4.68 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|