C30H34F3N3O5 — CID 70280560
(2R)-6-amino-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 70280560) has the molecular formula C30H34F3N3O5 and a molecular weight of 573.61 g/mol. Its IUPAC name is (2R)-6-amino-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-6-amino-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70280560 |
| Molecular Formula | C30H34F3N3O5 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (2R)-6-amino-2-[(2,2-diphenylacetyl)-[(4-methoxyphenyl)methyl]amino]hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCCCN)C(N)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H33N3O3.C2HF3O2/c1-34-24-17-15-21(16-18-24)20-31(25(27(30)32)14-8-9-19-29)28(33)26(22-10-4-2-5-11-22)23-12-6-3-7-13-23;3-2(4,5)1(6)7/h2-7,10-13,15-18,25-26H,8-9,14,19-20,29H2,1H3,(H2,30,32);(H,6,7)/t25-;/m1./s1 |
| InChIKey | PLCXJOHSWFLPCS-VQIWEWKSSA-N |
| XLogP | 4.47 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|