C31H36Cl2N4O4 — CID 57227911
tert-butyl N-[(4R)-5-amino-4-[(4-amino-3,5-dichlorophenyl)methyl-(2,2-diphenylacetyl)amino]-5-oxopentyl]carbamate (PubChem CID 57227911) has the molecular formula C31H36Cl2N4O4 and a molecular weight of 599.56 g/mol. Its IUPAC name is tert-butyl N-[(4R)-5-amino-4-[(4-amino-3,5-dichlorophenyl)methyl-(2,2-diphenylacetyl)amino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-5-amino-4-[(4-amino-3,5-dichlorophenyl)methyl-(2,2-diphenylacetyl)amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 57227911 |
| Molecular Formula | C31H36Cl2N4O4 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | tert-butyl N-[(4R)-5-amino-4-[(4-amino-3,5-dichlorophenyl)methyl-(2,2-diphenylacetyl)amino]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](C(N)=O)N(Cc1cc(Cl)c(N)c(Cl)c1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36Cl2N4O4/c1-31(2,3)41-30(40)36-16-10-15-25(28(35)38)37(19-20-17-23(32)27(34)24(33)18-20)29(39)26(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-9,11-14,17-18,25-26H,10,15-16,19,34H2,1-3H3,(H2,35,38)(H,36,40)/t25-/m1/s1 |
| InChIKey | FUHODZINOCSWEY-RUZDIDTESA-N |
| XLogP | 5.90 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|