C33H46N4O6 — CID 57283723
tert-butyl N-[(5S)-6-amino-5-[benzyl-[4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pent-2-enoyl]amino]-6-oxohexyl]carbamate (PubChem CID 57283723) has the molecular formula C33H46N4O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-amino-5-[benzyl-[4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pent-2-enoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-amino-5-[benzyl-[4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pent-2-enoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 57283723 |
| Molecular Formula | C33H46N4O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | tert-butyl N-[(5S)-6-amino-5-[benzyl-[4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pent-2-enoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)C=C(CC(=O)NOCc1ccccc1)C(=O)N(Cc1ccccc1)[C@@H](CCCCNC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C33H46N4O6/c1-24(2)20-27(21-29(38)36-42-23-26-16-10-7-11-17-26)31(40)37(22-25-14-8-6-9-15-25)28(30(34)39)18-12-13-19-35-32(41)43-33(3,4)5/h6-11,14-17,20,24,28H,12-13,18-19,21-23H2,1-5H3,(H2,34,39)(H,35,41)(H,36,38)/t28-/m0/s1 |
| InChIKey | YRUSLGPBZZPURV-NDEPHWFRSA-N |
| XLogP | 4.78 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|