C17H25F3N6O6 — CID 67793144
(2R)-5-amino-2-[(4-ethoxyphenyl)methyl-(N'-nitrocarbamimidoyl)amino]pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 67793144) has the molecular formula C17H25F3N6O6 and a molecular weight of 466.42 g/mol. Its IUPAC name is (2R)-5-amino-2-[(4-ethoxyphenyl)methyl-(N'-nitrocarbamimidoyl)amino]pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-5-amino-2-[(4-ethoxyphenyl)methyl-(N'-nitrocarbamimidoyl)amino]pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67793144 |
| Molecular Formula | C17H25F3N6O6 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (2R)-5-amino-2-[(4-ethoxyphenyl)methyl-(N'-nitrocarbamimidoyl)amino]pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc(CN(C(N)=N[N+](=O)[O-])[C@H](CCCN)C(N)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N6O4.C2HF3O2/c1-2-25-12-7-5-11(6-8-12)10-20(15(18)19-21(23)24)13(14(17)22)4-3-9-16;3-2(4,5)1(6)7/h5-8,13H,2-4,9-10,16H2,1H3,(H2,17,22)(H2,18,19);(H,6,7)/t13-;/m1./s1 |
| InChIKey | CMNJNPRHPVJTIA-BTQNPOSSSA-N |
| XLogP | 0.62 |
| TPSA | 200.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|