C14H18F3N3O3 — CID 151448718
2-[benzyl-[N'-(trifluoromethyl)carbamimidoyl]amino]-3-ethoxypropanoic acid (PubChem CID 151448718) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-[benzyl-[N'-(trifluoromethyl)carbamimidoyl]amino]-3-ethoxypropanoic acid.
| Compound Name | 2-[benzyl-[N'-(trifluoromethyl)carbamimidoyl]amino]-3-ethoxypropanoic acid |
|---|---|
| PubChem CID | 151448718 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[benzyl-[N'-(trifluoromethyl)carbamimidoyl]amino]-3-ethoxypropanoic acid |
| SMILES | CCOCC(C(=O)O)N(Cc1ccccc1)C(N)=NC(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O3/c1-2-23-9-11(12(21)22)20(13(18)19-14(15,16)17)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H2,18,19)(H,21,22) |
| InChIKey | PGAUMJFIKBPXGR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|