C12H17N3O4 — CID 151900231
2-[benzyl-(N'-methoxycarbamimidoyl)amino]-3-hydroxypropanoic acid (PubChem CID 151900231) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[benzyl-(N'-methoxycarbamimidoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[benzyl-(N'-methoxycarbamimidoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 151900231 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[benzyl-(N'-methoxycarbamimidoyl)amino]-3-hydroxypropanoic acid |
| SMILES | CON=C(N)N(Cc1ccccc1)C(CO)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-19-14-12(13)15(10(8-16)11(17)18)7-9-5-3-2-4-6-9/h2-6,10,16H,7-8H2,1H3,(H2,13,14)(H,17,18) |
| InChIKey | SSPPOTDNFOPQTP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|