C11H16N2O2 — CID 14621674
(2R)-2-[benzyl(methyl)amino]-3-hydroxypropanamide (PubChem CID 14621674) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R)-2-[benzyl(methyl)amino]-3-hydroxypropanamide.
| Compound Name | (2R)-2-[benzyl(methyl)amino]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 14621674 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2R)-2-[benzyl(methyl)amino]-3-hydroxypropanamide |
| SMILES | CN(Cc1ccccc1)[C@H](CO)C(N)=O |
| InChI | InChI=1S/C11H16N2O2/c1-13(10(8-14)11(12)15)7-9-5-3-2-4-6-9/h2-6,10,14H,7-8H2,1H3,(H2,12,15)/t10-/m1/s1 |
| InChIKey | VFPSDZGTJYUTTF-SNVBAGLBSA-N |
| XLogP | -0.04 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |