C11H15F2NO — CID 146267203
2-[benzyl(methyl)amino]-3,3-difluoropropan-1-ol (PubChem CID 146267203) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-3,3-difluoropropan-1-ol.
| Compound Name | 2-[benzyl(methyl)amino]-3,3-difluoropropan-1-ol |
|---|---|
| PubChem CID | 146267203 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[benzyl(methyl)amino]-3,3-difluoropropan-1-ol |
| SMILES | CN(Cc1ccccc1)C(CO)C(F)F |
| InChI | InChI=1S/C11H15F2NO/c1-14(10(8-15)11(12)13)7-9-5-3-2-4-6-9/h2-6,10-11,15H,7-8H2,1H3 |
| InChIKey | OPJYATGHWAALLJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |