C16H21ClN2O2 — CID 68952302
(2R)-2-[benzyl(methyl)amino]-2-phenylacetamide;hydrate;hydrochloride (PubChem CID 68952302) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is (2R)-2-[benzyl(methyl)amino]-2-phenylacetamide;hydrate;hydrochloride.
| Compound Name | (2R)-2-[benzyl(methyl)amino]-2-phenylacetamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 68952302 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2R)-2-[benzyl(methyl)amino]-2-phenylacetamide;hydrate;hydrochloride |
| SMILES | CN(Cc1ccccc1)[C@@H](C(N)=O)c1ccccc1.Cl.O |
| InChI | InChI=1S/C16H18N2O.ClH.H2O/c1-18(12-13-8-4-2-5-9-13)15(16(17)19)14-10-6-3-7-11-14;;/h2-11,15H,12H2,1H3,(H2,17,19);1H;1H2/t15-;;/m1../s1 |
| InChIKey | PTLYJQGPQVRNBP-QCUBGVIVSA-N |
| XLogP | 1.94 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |