C17H27NO6Si — CID 154027617
(2R)-2-[[tert-butyl(dimethyl)silyl]-phenylmethoxycarbonyloxyamino]-3-hydroxypropanoic acid (PubChem CID 154027617) has the molecular formula C17H27NO6Si and a molecular weight of 369.49 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]-phenylmethoxycarbonyloxyamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]-phenylmethoxycarbonyloxyamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 154027617 |
| Molecular Formula | C17H27NO6Si |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]-phenylmethoxycarbonyloxyamino]-3-hydroxypropanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)N(OC(=O)OCc1ccccc1)[C@H](CO)C(=O)O |
| InChI | InChI=1S/C17H27NO6Si/c1-17(2,3)25(4,5)18(14(11-19)15(20)21)24-16(22)23-12-13-9-7-6-8-10-13/h6-10,14,19H,11-12H2,1-5H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | ZXKGVJISVHODKN-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|