C29H33N7O6 — CID 54198927
[4-[[[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methyl carbamate (PubChem CID 54198927) has the molecular formula C29H33N7O6 and a molecular weight of 575.63 g/mol. Its IUPAC name is [4-[[[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methyl carbamate.
| Compound Name | [4-[[[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 54198927 |
| Molecular Formula | C29H33N7O6 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | [4-[[[(2R)-1-amino-5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCC/N=C(\N)N[N+](=O)[O-])C(N)=O)cc1 |
| InChI | InChI=1S/C29H33N7O6/c30-26(37)24(12-7-17-33-28(31)34-36(40)41)35(18-20-13-15-21(16-14-20)19-42-29(32)39)27(38)25(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,24-25H,7,12,17-19H2,(H2,30,37)(H2,32,39)(H3,31,33,34)/t24-/m1/s1 |
| InChIKey | PNVNCJWHFUCKAP-XMMPIXPASA-N |
| XLogP | 2.17 |
| TPSA | 209.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|