C24H28N6O5 — CID 54347106
(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-(4-hydroxybut-2-ynyl)amino]pentanamide (PubChem CID 54347106) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is (2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-(4-hydroxybut-2-ynyl)amino]pentanamide.
| Compound Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-(4-hydroxybut-2-ynyl)amino]pentanamide |
|---|---|
| PubChem CID | 54347106 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2,2-diphenylacetyl)-(4-hydroxybut-2-ynyl)amino]pentanamide |
| SMILES | NC(=O)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])N(CC#CCO)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N6O5/c25-22(32)20(14-9-15-27-24(26)28-30(34)35)29(16-7-8-17-31)23(33)21(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-6,10-13,20-21,31H,9,14-17H2,(H2,25,32)(H3,26,27,28)/t20-/m1/s1 |
| InChIKey | UDBKIIZSCBSBIL-HXUWFJFHSA-N |
| XLogP | 0.37 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|