C25H35N5O3 — CID 54260788
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-(5-hydroxypentyl)amino]pentanamide (PubChem CID 54260788) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-(5-hydroxypentyl)amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-(5-hydroxypentyl)amino]pentanamide |
|---|---|
| PubChem CID | 54260788 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-(5-hydroxypentyl)amino]pentanamide |
| SMILES | NC(=O)[C@@H](CCCN=C(N)N)N(CCCCCO)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35N5O3/c26-23(32)21(15-10-16-29-25(27)28)30(17-8-3-9-18-31)24(33)22(19-11-4-1-5-12-19)20-13-6-2-7-14-20/h1-2,4-7,11-14,21-22,31H,3,8-10,15-18H2,(H2,26,32)(H4,27,28,29)/t21-/m1/s1 |
| InChIKey | RDIUXKUYHFABIN-OAQYLSRUSA-N |
| XLogP | 1.72 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|