C28H33N5O3 — CID 67015266
(2R)-2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[[4-(hydroxymethyl)phenyl]methyl]pentanamide (PubChem CID 67015266) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[[4-(hydroxymethyl)phenyl]methyl]pentanamide.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[[4-(hydroxymethyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 67015266 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[[4-(hydroxymethyl)phenyl]methyl]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)N(Cc1ccc(CO)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N5O3/c29-24(12-7-17-32-28(30)31)26(35)33(18-20-13-15-21(19-34)16-14-20)27(36)25(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,24-25,34H,7,12,17-19,29H2,(H4,30,31,32)/t24-/m1/s1 |
| InChIKey | MRXNFOJOTVMTSH-XMMPIXPASA-N |
| XLogP | 2.25 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|