C27H31N5O3 — CID 18357175
2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[(3-hydroxyphenyl)methyl]pentanamide (PubChem CID 18357175) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[(3-hydroxyphenyl)methyl]pentanamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[(3-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 18357175 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-N-[(3-hydroxyphenyl)methyl]pentanamide |
| SMILES | NC(N)=NCCCC(N)C(=O)N(Cc1cccc(O)c1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N5O3/c28-23(15-8-16-31-27(29)30)25(34)32(18-19-9-7-14-22(33)17-19)26(35)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-7,9-14,17,23-24,33H,8,15-16,18,28H2,(H4,29,30,31) |
| InChIKey | IAGSMULLOXOFQI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|