C24H27N5O5 — CID 18600623
benzyl N-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-N-(4-methyl-2-oxochromen-7-yl)carbamate (PubChem CID 18600623) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is benzyl N-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-N-(4-methyl-2-oxochromen-7-yl)carbamate.
| Compound Name | benzyl N-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-N-(4-methyl-2-oxochromen-7-yl)carbamate |
|---|---|
| PubChem CID | 18600623 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | benzyl N-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-N-(4-methyl-2-oxochromen-7-yl)carbamate |
| SMILES | Cc1cc(=O)oc2cc(N(C(=O)OCc3ccccc3)C(=O)[C@@H](N)CCCN=C(N)N)ccc12 |
| InChI | InChI=1S/C24H27N5O5/c1-15-12-21(30)34-20-13-17(9-10-18(15)20)29(22(31)19(25)8-5-11-28-23(26)27)24(32)33-14-16-6-3-2-4-7-16/h2-4,6-7,9-10,12-13,19H,5,8,11,14,25H2,1H3,(H4,26,27,28)/t19-/m0/s1 |
| InChIKey | MMQWUTRTFSJWAS-IBGZPJMESA-N |
| XLogP | 2.15 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|